C12H11BrClN3O — CID 47446049
N-[(4-bromo-2-chlorophenyl)methyl]-5-methyl-1H-pyrazole-3-carboxamide (PubChem CID 47446049) has the molecular formula C12H11BrClN3O and a molecular weight of 328.60 g/mol. Its IUPAC name is N-[(4-bromo-2-chlorophenyl)methyl]-5-methyl-1H-pyrazole-3-carboxamide.
| Compound Name | N-[(4-bromo-2-chlorophenyl)methyl]-5-methyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 47446049 |
| Molecular Formula | C12H11BrClN3O |
| Molecular Weight | 328.60 g/mol |
| Exact Mass | 326.98 |
| IUPAC Name | N-[(4-bromo-2-chlorophenyl)methyl]-5-methyl-1H-pyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCc2ccc(Br)cc2Cl)n[nH]1 |
| InChI | InChI=1S/C12H11BrClN3O/c1-7-4-11(17-16-7)12(18)15-6-8-2-3-9(13)5-10(8)14/h2-5H,6H2,1H3,(H,15,18)(H,16,17) |
| InChIKey | JLAZUXCNMCGQOP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.60 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |