C11H18BrN3O — CID 141446683
N-(6-bromohexyl)-5-methyl-1H-pyrazole-3-carboxamide (PubChem CID 141446683) has the molecular formula C11H18BrN3O and a molecular weight of 288.19 g/mol. Its IUPAC name is N-(6-bromohexyl)-5-methyl-1H-pyrazole-3-carboxamide.
| Compound Name | N-(6-bromohexyl)-5-methyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 141446683 |
| Molecular Formula | C11H18BrN3O |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | N-(6-bromohexyl)-5-methyl-1H-pyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCCCCCCBr)n[nH]1 |
| InChI | InChI=1S/C11H18BrN3O/c1-9-8-10(15-14-9)11(16)13-7-5-3-2-4-6-12/h8H,2-7H2,1H3,(H,13,16)(H,14,15) |
| InChIKey | LWUDZLHAQHJNEV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|