C13H22N4O2 — CID 71346088
3-N,5-N-dibutyl-1H-pyrazole-3,5-dicarboxamide (PubChem CID 71346088) has the molecular formula C13H22N4O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is 3-N,5-N-dibutyl-1H-pyrazole-3,5-dicarboxamide.
| Compound Name | 3-N,5-N-dibutyl-1H-pyrazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 71346088 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 3-N,5-N-dibutyl-1H-pyrazole-3,5-dicarboxamide |
| SMILES | CCCCNC(=O)c1cc(C(=O)NCCCC)[nH]n1 |
| InChI | InChI=1S/C13H22N4O2/c1-3-5-7-14-12(18)10-9-11(17-16-10)13(19)15-8-6-4-2/h9H,3-8H2,1-2H3,(H,14,18)(H,15,19)(H,16,17) |
| InChIKey | IJSWPBVTZBWCES-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|