C9H14N4O4 — CID 163353826
3-N,5-N-bis(2-hydroxyethyl)-1H-pyrazole-3,5-dicarboxamide (PubChem CID 163353826) has the molecular formula C9H14N4O4 and a molecular weight of 242.23 g/mol. Its IUPAC name is 3-N,5-N-bis(2-hydroxyethyl)-1H-pyrazole-3,5-dicarboxamide.
| Compound Name | 3-N,5-N-bis(2-hydroxyethyl)-1H-pyrazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 163353826 |
| Molecular Formula | C9H14N4O4 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 3-N,5-N-bis(2-hydroxyethyl)-1H-pyrazole-3,5-dicarboxamide |
| SMILES | O=C(NCCO)c1cc(C(=O)NCCO)[nH]n1 |
| InChI | InChI=1S/C9H14N4O4/c14-3-1-10-8(16)6-5-7(13-12-6)9(17)11-2-4-15/h5,14-15H,1-4H2,(H,10,16)(H,11,17)(H,12,13) |
| InChIKey | JTFGECNKLCSDTB-UHFFFAOYSA-N |
| XLogP | -2.15 |
| TPSA | 127.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |