C8H14N4O2 — CID 106840125
3-amino-N-(4-hydroxybutyl)-1H-pyrazole-5-carboxamide (PubChem CID 106840125) has the molecular formula C8H14N4O2 and a molecular weight of 198.23 g/mol. Its IUPAC name is 3-amino-N-(4-hydroxybutyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 3-amino-N-(4-hydroxybutyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 106840125 |
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 3-amino-N-(4-hydroxybutyl)-1H-pyrazole-5-carboxamide |
| SMILES | Nc1cc(C(=O)NCCCCO)[nH]n1 |
| InChI | InChI=1S/C8H14N4O2/c9-7-5-6(11-12-7)8(14)10-3-1-2-4-13/h5,13H,1-4H2,(H,10,14)(H3,9,11,12) |
| InChIKey | GAAHURXWEMZALU-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|