C9H15N5O2 — CID 106233227
3-amino-N-(5-amino-5-oxopentyl)-1H-pyrazole-5-carboxamide (PubChem CID 106233227) has the molecular formula C9H15N5O2 and a molecular weight of 225.25 g/mol. Its IUPAC name is 3-amino-N-(5-amino-5-oxopentyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 3-amino-N-(5-amino-5-oxopentyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 106233227 |
| Molecular Formula | C9H15N5O2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 3-amino-N-(5-amino-5-oxopentyl)-1H-pyrazole-5-carboxamide |
| SMILES | NC(=O)CCCCNC(=O)c1cc(N)n[nH]1 |
| InChI | InChI=1S/C9H15N5O2/c10-7-5-6(13-14-7)9(16)12-4-2-1-3-8(11)15/h5H,1-4H2,(H2,11,15)(H,12,16)(H3,10,13,14) |
| InChIKey | UHIOOJNCARVOCP-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 126.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|