C8H13N5O2 — CID 64524226
3-amino-N-[2-(ethylamino)-2-oxoethyl]-1H-pyrazole-5-carboxamide (PubChem CID 64524226) has the molecular formula C8H13N5O2 and a molecular weight of 211.22 g/mol. Its IUPAC name is 3-amino-N-[2-(ethylamino)-2-oxoethyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-amino-N-[2-(ethylamino)-2-oxoethyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 64524226 |
| Molecular Formula | C8H13N5O2 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 3-amino-N-[2-(ethylamino)-2-oxoethyl]-1H-pyrazole-5-carboxamide |
| SMILES | CCNC(=O)CNC(=O)c1cc(N)n[nH]1 |
| InChI | InChI=1S/C8H13N5O2/c1-2-10-7(14)4-11-8(15)5-3-6(9)13-12-5/h3H,2,4H2,1H3,(H,10,14)(H,11,15)(H3,9,12,13) |
| InChIKey | YRLMHBGPLNMKBO-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |