C8H12N4O4 — CID 107211630
methyl 3-[(3-amino-1H-pyrazole-5-carbonyl)amino]-2-hydroxypropanoate (PubChem CID 107211630) has the molecular formula C8H12N4O4 and a molecular weight of 228.21 g/mol. Its IUPAC name is methyl 3-[(3-amino-1H-pyrazole-5-carbonyl)amino]-2-hydroxypropanoate.
| Compound Name | methyl 3-[(3-amino-1H-pyrazole-5-carbonyl)amino]-2-hydroxypropanoate |
|---|---|
| PubChem CID | 107211630 |
| Molecular Formula | C8H12N4O4 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | methyl 3-[(3-amino-1H-pyrazole-5-carbonyl)amino]-2-hydroxypropanoate |
| SMILES | COC(=O)C(O)CNC(=O)c1cc(N)n[nH]1 |
| InChI | InChI=1S/C8H12N4O4/c1-16-8(15)5(13)3-10-7(14)4-2-6(9)12-11-4/h2,5,13H,3H2,1H3,(H,10,14)(H3,9,11,12) |
| InChIKey | XAYZMYDMIDRSGO-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 130.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |