C9H16N4O2 — CID 65103461
3-amino-N-(2-hydroxy-2-methylbutyl)-1H-pyrazole-5-carboxamide (PubChem CID 65103461) has the molecular formula C9H16N4O2 and a molecular weight of 212.25 g/mol. Its IUPAC name is 3-amino-N-(2-hydroxy-2-methylbutyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 3-amino-N-(2-hydroxy-2-methylbutyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 65103461 |
| Molecular Formula | C9H16N4O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 3-amino-N-(2-hydroxy-2-methylbutyl)-1H-pyrazole-5-carboxamide |
| SMILES | CCC(C)(O)CNC(=O)c1cc(N)n[nH]1 |
| InChI | InChI=1S/C9H16N4O2/c1-3-9(2,15)5-11-8(14)6-4-7(10)13-12-6/h4,15H,3,5H2,1-2H3,(H,11,14)(H3,10,12,13) |
| InChIKey | JAZPEROHTVWHOT-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |