C7H10FN3O — CID 130978682
N-(2-fluoroethyl)-5-methyl-1H-pyrazole-3-carboxamide (PubChem CID 130978682) has the molecular formula C7H10FN3O and a molecular weight of 171.17 g/mol. Its IUPAC name is N-(2-fluoroethyl)-5-methyl-1H-pyrazole-3-carboxamide.
| Compound Name | N-(2-fluoroethyl)-5-methyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 130978682 |
| Molecular Formula | C7H10FN3O |
| Molecular Weight | 171.17 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | N-(2-fluoroethyl)-5-methyl-1H-pyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCCF)n[nH]1 |
| InChI | InChI=1S/C7H10FN3O/c1-5-4-6(11-10-5)7(12)9-3-2-8/h4H,2-3H2,1H3,(H,9,12)(H,10,11) |
| InChIKey | GJIRZGJFBZIFNA-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.17 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |