C9H13N3O3S — CID 139018658
5-methyl-N-[(E)-3-methylsulfonylprop-2-enyl]-1H-pyrazole-3-carboxamide (PubChem CID 139018658) has the molecular formula C9H13N3O3S and a molecular weight of 243.29 g/mol. Its IUPAC name is 5-methyl-N-[(E)-3-methylsulfonylprop-2-enyl]-1H-pyrazole-3-carboxamide.
| Compound Name | 5-methyl-N-[(E)-3-methylsulfonylprop-2-enyl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 139018658 |
| Molecular Formula | C9H13N3O3S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 5-methyl-N-[(E)-3-methylsulfonylprop-2-enyl]-1H-pyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NC/C=C/S(C)(=O)=O)n[nH]1 |
| InChI | InChI=1S/C9H13N3O3S/c1-7-6-8(12-11-7)9(13)10-4-3-5-16(2,14)15/h3,5-6H,4H2,1-2H3,(H,10,13)(H,11,12)/b5-3+ |
| InChIKey | HDYKRLPQYOSECR-HWKANZROSA-N |
| XLogP | 0.01 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |