C6H9N3O2 — CID 126988470
N-methoxy-5-methyl-1H-pyrazole-3-carboxamide (PubChem CID 126988470) has the molecular formula C6H9N3O2 and a molecular weight of 155.16 g/mol. Its IUPAC name is N-methoxy-5-methyl-1H-pyrazole-3-carboxamide.
| Compound Name | N-methoxy-5-methyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 126988470 |
| Molecular Formula | C6H9N3O2 |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | N-methoxy-5-methyl-1H-pyrazole-3-carboxamide |
| SMILES | CONC(=O)c1cc(C)[nH]n1 |
| InChI | InChI=1S/C6H9N3O2/c1-4-3-5(8-7-4)6(10)9-11-2/h3H,1-2H3,(H,7,8)(H,9,10) |
| InChIKey | BJJSWNIKKLYRLZ-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|