C9H13N3O — CID 126992210
N-but-3-en-2-yl-5-methyl-1H-pyrazole-3-carboxamide (PubChem CID 126992210) has the molecular formula C9H13N3O and a molecular weight of 179.22 g/mol. Its IUPAC name is N-but-3-en-2-yl-5-methyl-1H-pyrazole-3-carboxamide.
| Compound Name | N-but-3-en-2-yl-5-methyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 126992210 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | N-but-3-en-2-yl-5-methyl-1H-pyrazole-3-carboxamide |
| SMILES | C=CC(C)NC(=O)c1cc(C)[nH]n1 |
| InChI | InChI=1S/C9H13N3O/c1-4-6(2)10-9(13)8-5-7(3)11-12-8/h4-6H,1H2,2-3H3,(H,10,13)(H,11,12) |
| InChIKey | NHBGJNAZPCXQMT-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|