C6H7N4OS2- — CID 135590483
N-[(5-methyl-1H-pyrazole-3-carbonyl)amino]carbamodithioate (PubChem CID 135590483) has the molecular formula C6H7N4OS2- and a molecular weight of 215.28 g/mol. Its IUPAC name is N-[(5-methyl-1H-pyrazole-3-carbonyl)amino]carbamodithioate.
| Compound Name | N-[(5-methyl-1H-pyrazole-3-carbonyl)amino]carbamodithioate |
|---|---|
| PubChem CID | 135590483 |
| Molecular Formula | C6H7N4OS2- |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.01 |
| IUPAC Name | N-[(5-methyl-1H-pyrazole-3-carbonyl)amino]carbamodithioate |
| SMILES | Cc1cc(C(=O)NNC(=S)[S-])n[nH]1 |
| InChI | InChI=1S/C6H8N4OS2/c1-3-2-4(8-7-3)5(11)9-10-6(12)13/h2H,1H3,(H,7,8)(H,9,11)(H2,10,12,13)/p-1 |
| InChIKey | GHGBEENQMZDJSZ-UHFFFAOYSA-M |
| XLogP | -0.22 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|