C14H14BrN5O3S — CID 4502341
3-bromo-4-methoxy-N-[[(5-methyl-1H-pyrazole-3-carbonyl)amino]carbamothioyl]benzamide (PubChem CID 4502341) has the molecular formula C14H14BrN5O3S and a molecular weight of 412.27 g/mol. Its IUPAC name is 3-bromo-4-methoxy-N-[[(5-methyl-1H-pyrazole-3-carbonyl)amino]carbamothioyl]benzamide.
| Compound Name | 3-bromo-4-methoxy-N-[[(5-methyl-1H-pyrazole-3-carbonyl)amino]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4502341 |
| Molecular Formula | C14H14BrN5O3S |
| Molecular Weight | 412.27 g/mol |
| Exact Mass | 411.00 |
| IUPAC Name | 3-bromo-4-methoxy-N-[[(5-methyl-1H-pyrazole-3-carbonyl)amino]carbamothioyl]benzamide |
| SMILES | COc1ccc(C(=O)NC(=S)NNC(=O)c2cc(C)[nH]n2)cc1Br |
| InChI | InChI=1S/C14H14BrN5O3S/c1-7-5-10(18-17-7)13(22)19-20-14(24)16-12(21)8-3-4-11(23-2)9(15)6-8/h3-6H,1-2H3,(H,17,18)(H,19,22)(H2,16,20,21,24) |
| InChIKey | RKFOXMRZUKKRJB-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 108.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.27 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|