C15H16BrN5O3S — CID 4504420
2-(2-bromo-4-methylphenoxy)-N-[[(5-methyl-1H-pyrazole-3-carbonyl)amino]carbamothioyl]acetamide (PubChem CID 4504420) has the molecular formula C15H16BrN5O3S and a molecular weight of 426.30 g/mol. Its IUPAC name is 2-(2-bromo-4-methylphenoxy)-N-[[(5-methyl-1H-pyrazole-3-carbonyl)amino]carbamothioyl]acetamide.
| Compound Name | 2-(2-bromo-4-methylphenoxy)-N-[[(5-methyl-1H-pyrazole-3-carbonyl)amino]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 4504420 |
| Molecular Formula | C15H16BrN5O3S |
| Molecular Weight | 426.30 g/mol |
| Exact Mass | 425.02 |
| IUPAC Name | 2-(2-bromo-4-methylphenoxy)-N-[[(5-methyl-1H-pyrazole-3-carbonyl)amino]carbamothioyl]acetamide |
| SMILES | Cc1ccc(OCC(=O)NC(=S)NNC(=O)c2cc(C)[nH]n2)c(Br)c1 |
| InChI | InChI=1S/C15H16BrN5O3S/c1-8-3-4-12(10(16)5-8)24-7-13(22)17-15(25)21-20-14(23)11-6-9(2)18-19-11/h3-6H,7H2,1-2H3,(H,18,19)(H,20,23)(H2,17,21,22,25) |
| InChIKey | GIZKAJONNNZVFR-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 108.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.30 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|