C14H16BrN3O3S — CID 4504413
2-(2-bromo-4-methylphenoxy)-N-[(cyclopropanecarbonylamino)carbamothioyl]acetamide (PubChem CID 4504413) has the molecular formula C14H16BrN3O3S and a molecular weight of 386.27 g/mol. Its IUPAC name is 2-(2-bromo-4-methylphenoxy)-N-[(cyclopropanecarbonylamino)carbamothioyl]acetamide.
| Compound Name | 2-(2-bromo-4-methylphenoxy)-N-[(cyclopropanecarbonylamino)carbamothioyl]acetamide |
|---|---|
| PubChem CID | 4504413 |
| Molecular Formula | C14H16BrN3O3S |
| Molecular Weight | 386.27 g/mol |
| Exact Mass | 385.01 |
| IUPAC Name | 2-(2-bromo-4-methylphenoxy)-N-[(cyclopropanecarbonylamino)carbamothioyl]acetamide |
| SMILES | Cc1ccc(OCC(=O)NC(=S)NNC(=O)C2CC2)c(Br)c1 |
| InChI | InChI=1S/C14H16BrN3O3S/c1-8-2-5-11(10(15)6-8)21-7-12(19)16-14(22)18-17-13(20)9-3-4-9/h2,5-6,9H,3-4,7H2,1H3,(H,17,20)(H2,16,18,19,22) |
| InChIKey | LTLYSRHNGHPDCY-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.27 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|