C15H17N5O2S — CID 5089948
N-[[(5-methyl-1H-pyrazole-3-carbonyl)amino]carbamothioyl]-3-phenylpropanamide (PubChem CID 5089948) has the molecular formula C15H17N5O2S and a molecular weight of 331.40 g/mol. Its IUPAC name is N-[[(5-methyl-1H-pyrazole-3-carbonyl)amino]carbamothioyl]-3-phenylpropanamide.
| Compound Name | N-[[(5-methyl-1H-pyrazole-3-carbonyl)amino]carbamothioyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 5089948 |
| Molecular Formula | C15H17N5O2S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | N-[[(5-methyl-1H-pyrazole-3-carbonyl)amino]carbamothioyl]-3-phenylpropanamide |
| SMILES | Cc1cc(C(=O)NNC(=S)NC(=O)CCc2ccccc2)n[nH]1 |
| InChI | InChI=1S/C15H17N5O2S/c1-10-9-12(18-17-10)14(22)19-20-15(23)16-13(21)8-7-11-5-3-2-4-6-11/h2-6,9H,7-8H2,1H3,(H,17,18)(H,19,22)(H2,16,20,21,23) |
| InChIKey | OQQOKZPWGYRTCO-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 98.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|