C17H22N4O3 — CID 3321462
N'-[2-(4-tert-butylphenoxy)acetyl]-5-methyl-1H-pyrazole-3-carbohydrazide (PubChem CID 3321462) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is N'-[2-(4-tert-butylphenoxy)acetyl]-5-methyl-1H-pyrazole-3-carbohydrazide.
| Compound Name | N'-[2-(4-tert-butylphenoxy)acetyl]-5-methyl-1H-pyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 3321462 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | N'-[2-(4-tert-butylphenoxy)acetyl]-5-methyl-1H-pyrazole-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)COc2ccc(C(C)(C)C)cc2)n[nH]1 |
| InChI | InChI=1S/C17H22N4O3/c1-11-9-14(19-18-11)16(23)21-20-15(22)10-24-13-7-5-12(6-8-13)17(2,3)4/h5-9H,10H2,1-4H3,(H,18,19)(H,20,22)(H,21,23) |
| InChIKey | NCHCYCXAJCUBAS-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|