C9H11N5O — CID 47470885
5-methyl-N-(5-methyl-1H-pyrazol-4-yl)-1H-pyrazole-3-carboxamide (PubChem CID 47470885) has the molecular formula C9H11N5O and a molecular weight of 205.22 g/mol. Its IUPAC name is 5-methyl-N-(5-methyl-1H-pyrazol-4-yl)-1H-pyrazole-3-carboxamide.
| Compound Name | 5-methyl-N-(5-methyl-1H-pyrazol-4-yl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 47470885 |
| Molecular Formula | C9H11N5O |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 5-methyl-N-(5-methyl-1H-pyrazol-4-yl)-1H-pyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cn[nH]c2C)n[nH]1 |
| InChI | InChI=1S/C9H11N5O/c1-5-3-7(14-12-5)9(15)11-8-4-10-13-6(8)2/h3-4H,1-2H3,(H,10,13)(H,11,15)(H,12,14) |
| InChIKey | HRXGEQAHIQBUHW-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |