C7H12N4O — CID 20784611
1,1-dimethyl-3-(5-methyl-1H-pyrazol-4-yl)urea (PubChem CID 20784611) has the molecular formula C7H12N4O and a molecular weight of 168.20 g/mol. Its IUPAC name is 1,1-dimethyl-3-(5-methyl-1H-pyrazol-4-yl)urea.
| Compound Name | 1,1-dimethyl-3-(5-methyl-1H-pyrazol-4-yl)urea |
|---|---|
| PubChem CID | 20784611 |
| Molecular Formula | C7H12N4O |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 1,1-dimethyl-3-(5-methyl-1H-pyrazol-4-yl)urea |
| SMILES | Cc1[nH]ncc1NC(=O)N(C)C |
| InChI | InChI=1S/C7H12N4O/c1-5-6(4-8-10-5)9-7(12)11(2)3/h4H,1-3H3,(H,8,10)(H,9,12) |
| InChIKey | QZMZPRFYDSYCKY-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |