C14H18N6O2 — CID 112521754
2-[(dimethylcarbamoylamino)methyl]-N-(5-methyl-1H-pyrazol-4-yl)pyridine-4-carboxamide (PubChem CID 112521754) has the molecular formula C14H18N6O2 and a molecular weight of 302.34 g/mol. Its IUPAC name is 2-[(dimethylcarbamoylamino)methyl]-N-(5-methyl-1H-pyrazol-4-yl)pyridine-4-carboxamide.
| Compound Name | 2-[(dimethylcarbamoylamino)methyl]-N-(5-methyl-1H-pyrazol-4-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 112521754 |
| Molecular Formula | C14H18N6O2 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 2-[(dimethylcarbamoylamino)methyl]-N-(5-methyl-1H-pyrazol-4-yl)pyridine-4-carboxamide |
| SMILES | Cc1[nH]ncc1NC(=O)c1ccnc(CNC(=O)N(C)C)c1 |
| InChI | InChI=1S/C14H18N6O2/c1-9-12(8-17-19-9)18-13(21)10-4-5-15-11(6-10)7-16-14(22)20(2)3/h4-6,8H,7H2,1-3H3,(H,16,22)(H,17,19)(H,18,21) |
| InChIKey | XIZRLQBXXYOZHW-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |