C8H13N3O — CID 130719724
2-methyl-N-(5-methyl-1H-pyrazol-4-yl)propanamide (PubChem CID 130719724) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is 2-methyl-N-(5-methyl-1H-pyrazol-4-yl)propanamide.
| Compound Name | 2-methyl-N-(5-methyl-1H-pyrazol-4-yl)propanamide |
|---|---|
| PubChem CID | 130719724 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 2-methyl-N-(5-methyl-1H-pyrazol-4-yl)propanamide |
| SMILES | Cc1[nH]ncc1NC(=O)C(C)C |
| InChI | InChI=1S/C8H13N3O/c1-5(2)8(12)10-7-4-9-11-6(7)3/h4-5H,1-3H3,(H,9,11)(H,10,12) |
| InChIKey | QUSNAQWFTQGWHI-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |