C14H17N3O3 — CID 112521695
3-(3,4-dihydroxyphenyl)-2-methyl-N-(5-methyl-1H-pyrazol-4-yl)propanamide (PubChem CID 112521695) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 3-(3,4-dihydroxyphenyl)-2-methyl-N-(5-methyl-1H-pyrazol-4-yl)propanamide.
| Compound Name | 3-(3,4-dihydroxyphenyl)-2-methyl-N-(5-methyl-1H-pyrazol-4-yl)propanamide |
|---|---|
| PubChem CID | 112521695 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)-2-methyl-N-(5-methyl-1H-pyrazol-4-yl)propanamide |
| SMILES | Cc1[nH]ncc1NC(=O)C(C)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C14H17N3O3/c1-8(5-10-3-4-12(18)13(19)6-10)14(20)16-11-7-15-17-9(11)2/h3-4,6-8,18-19H,5H2,1-2H3,(H,15,17)(H,16,20) |
| InChIKey | FZMTVXJSUJFHSW-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 98.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|