C13H16N4O3 — CID 104618999
(2S)-2-amino-3-(3,4-dihydroxyphenyl)-N-(4-methyl-1H-pyrazol-5-yl)propanamide (PubChem CID 104618999) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is (2S)-2-amino-3-(3,4-dihydroxyphenyl)-N-(4-methyl-1H-pyrazol-5-yl)propanamide.
| Compound Name | (2S)-2-amino-3-(3,4-dihydroxyphenyl)-N-(4-methyl-1H-pyrazol-5-yl)propanamide |
|---|---|
| PubChem CID | 104618999 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | (2S)-2-amino-3-(3,4-dihydroxyphenyl)-N-(4-methyl-1H-pyrazol-5-yl)propanamide |
| SMILES | Cc1cn[nH]c1NC(=O)[C@@H](N)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C13H16N4O3/c1-7-6-15-17-12(7)16-13(20)9(14)4-8-2-3-10(18)11(19)5-8/h2-3,5-6,9,18-19H,4,14H2,1H3,(H2,15,16,17,20)/t9-/m0/s1 |
| InChIKey | QTQNIMIKNIOULM-VIFPVBQESA-N |
| XLogP | 0.64 |
| TPSA | 124.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|