C19H18N2O3 — CID 84578370
3-(3,4-dihydroxyphenyl)-2-methyl-N-quinolin-8-ylpropanamide (PubChem CID 84578370) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is 3-(3,4-dihydroxyphenyl)-2-methyl-N-quinolin-8-ylpropanamide.
| Compound Name | 3-(3,4-dihydroxyphenyl)-2-methyl-N-quinolin-8-ylpropanamide |
|---|---|
| PubChem CID | 84578370 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)-2-methyl-N-quinolin-8-ylpropanamide |
| SMILES | CC(Cc1ccc(O)c(O)c1)C(=O)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C19H18N2O3/c1-12(10-13-7-8-16(22)17(23)11-13)19(24)21-15-6-2-4-14-5-3-9-20-18(14)15/h2-9,11-12,22-23H,10H2,1H3,(H,21,24) |
| InChIKey | LOEVOOXPZIPESZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|