C16H13N3O4 — CID 108871921
1-quinolin-8-yl-3-(3,4,5-trihydroxyphenyl)urea (PubChem CID 108871921) has the molecular formula C16H13N3O4 and a molecular weight of 311.30 g/mol. Its IUPAC name is 1-quinolin-8-yl-3-(3,4,5-trihydroxyphenyl)urea.
| Compound Name | 1-quinolin-8-yl-3-(3,4,5-trihydroxyphenyl)urea |
|---|---|
| PubChem CID | 108871921 |
| Molecular Formula | C16H13N3O4 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 1-quinolin-8-yl-3-(3,4,5-trihydroxyphenyl)urea |
| SMILES | O=C(Nc1cc(O)c(O)c(O)c1)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C16H13N3O4/c20-12-7-10(8-13(21)15(12)22)18-16(23)19-11-5-1-3-9-4-2-6-17-14(9)11/h1-8,20-22H,(H2,18,19,23) |
| InChIKey | UPVZQJZFCXACRW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|