C17H11Cl2N3O2 — CID 108501076
N'-(2,5-dichlorophenyl)-N-quinolin-8-yloxamide (PubChem CID 108501076) has the molecular formula C17H11Cl2N3O2 and a molecular weight of 360.20 g/mol. Its IUPAC name is N'-(2,5-dichlorophenyl)-N-quinolin-8-yloxamide.
| Compound Name | N'-(2,5-dichlorophenyl)-N-quinolin-8-yloxamide |
|---|---|
| PubChem CID | 108501076 |
| Molecular Formula | C17H11Cl2N3O2 |
| Molecular Weight | 360.20 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | N'-(2,5-dichlorophenyl)-N-quinolin-8-yloxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1Cl)C(=O)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C17H11Cl2N3O2/c18-11-6-7-12(19)14(9-11)22-17(24)16(23)21-13-5-1-3-10-4-2-8-20-15(10)13/h1-9H,(H,21,23)(H,22,24) |
| InChIKey | FQABYYSZYGNBED-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.20 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|