C17H13Cl2N3O — CID 109010978
N-(2,5-dichlorophenyl)-2-(quinolin-8-ylamino)acetamide (PubChem CID 109010978) has the molecular formula C17H13Cl2N3O and a molecular weight of 346.22 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2-(quinolin-8-ylamino)acetamide.
| Compound Name | N-(2,5-dichlorophenyl)-2-(quinolin-8-ylamino)acetamide |
|---|---|
| PubChem CID | 109010978 |
| Molecular Formula | C17H13Cl2N3O |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2-(quinolin-8-ylamino)acetamide |
| SMILES | O=C(CNc1cccc2cccnc12)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H13Cl2N3O/c18-12-6-7-13(19)15(9-12)22-16(23)10-21-14-5-1-3-11-4-2-8-20-17(11)14/h1-9,21H,10H2,(H,22,23) |
| InChIKey | OJVOGJJBHRRPHS-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |