C19H13Cl2N5 — CID 112906494
2-N-(2,5-dichlorophenyl)-4-N-quinolin-8-ylpyrimidine-2,4-diamine (PubChem CID 112906494) has the molecular formula C19H13Cl2N5 and a molecular weight of 382.25 g/mol. Its IUPAC name is 2-N-(2,5-dichlorophenyl)-4-N-quinolin-8-ylpyrimidine-2,4-diamine.
| Compound Name | 2-N-(2,5-dichlorophenyl)-4-N-quinolin-8-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112906494 |
| Molecular Formula | C19H13Cl2N5 |
| Molecular Weight | 382.25 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | 2-N-(2,5-dichlorophenyl)-4-N-quinolin-8-ylpyrimidine-2,4-diamine |
| SMILES | Clc1ccc(Cl)c(Nc2nccc(Nc3cccc4cccnc34)n2)c1 |
| InChI | InChI=1S/C19H13Cl2N5/c20-13-6-7-14(21)16(11-13)25-19-23-10-8-17(26-19)24-15-5-1-3-12-4-2-9-22-18(12)15/h1-11H,(H2,23,24,25,26) |
| InChIKey | FOSINXICLFZTLI-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.25 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |