C23H23N5 — CID 112903339
4-N-(2-tert-butylphenyl)-2-N-quinolin-8-ylpyrimidine-2,4-diamine (PubChem CID 112903339) has the molecular formula C23H23N5 and a molecular weight of 369.47 g/mol. Its IUPAC name is 4-N-(2-tert-butylphenyl)-2-N-quinolin-8-ylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(2-tert-butylphenyl)-2-N-quinolin-8-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112903339 |
| Molecular Formula | C23H23N5 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | 4-N-(2-tert-butylphenyl)-2-N-quinolin-8-ylpyrimidine-2,4-diamine |
| SMILES | CC(C)(C)c1ccccc1Nc1ccnc(Nc2cccc3cccnc23)n1 |
| InChI | InChI=1S/C23H23N5/c1-23(2,3)17-10-4-5-11-18(17)26-20-13-15-25-22(28-20)27-19-12-6-8-16-9-7-14-24-21(16)19/h4-15H,1-3H3,(H2,25,26,27,28) |
| InChIKey | AFPULSAAEHQYNV-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |