C24H26N6 — CID 112906512
4-N-[4-(diethylamino)-2-methylphenyl]-2-N-quinolin-8-ylpyrimidine-2,4-diamine (PubChem CID 112906512) has the molecular formula C24H26N6 and a molecular weight of 398.51 g/mol. Its IUPAC name is 4-N-[4-(diethylamino)-2-methylphenyl]-2-N-quinolin-8-ylpyrimidine-2,4-diamine.
| Compound Name | 4-N-[4-(diethylamino)-2-methylphenyl]-2-N-quinolin-8-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112906512 |
| Molecular Formula | C24H26N6 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 4-N-[4-(diethylamino)-2-methylphenyl]-2-N-quinolin-8-ylpyrimidine-2,4-diamine |
| SMILES | CCN(CC)c1ccc(Nc2ccnc(Nc3cccc4cccnc34)n2)c(C)c1 |
| InChI | InChI=1S/C24H26N6/c1-4-30(5-2)19-11-12-20(17(3)16-19)27-22-13-15-26-24(29-22)28-21-10-6-8-18-9-7-14-25-23(18)21/h6-16H,4-5H2,1-3H3,(H2,26,27,28,29) |
| InChIKey | LTTKBUQOSHCUFE-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|