C23H29N5 — CID 112890511
4-N-[4-(diethylamino)-2-methylphenyl]-2-N-[(4-methylphenyl)methyl]pyrimidine-2,4-diamine (PubChem CID 112890511) has the molecular formula C23H29N5 and a molecular weight of 375.52 g/mol. Its IUPAC name is 4-N-[4-(diethylamino)-2-methylphenyl]-2-N-[(4-methylphenyl)methyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-[4-(diethylamino)-2-methylphenyl]-2-N-[(4-methylphenyl)methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112890511 |
| Molecular Formula | C23H29N5 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | 4-N-[4-(diethylamino)-2-methylphenyl]-2-N-[(4-methylphenyl)methyl]pyrimidine-2,4-diamine |
| SMILES | CCN(CC)c1ccc(Nc2ccnc(NCc3ccc(C)cc3)n2)c(C)c1 |
| InChI | InChI=1S/C23H29N5/c1-5-28(6-2)20-11-12-21(18(4)15-20)26-22-13-14-24-23(27-22)25-16-19-9-7-17(3)8-10-19/h7-15H,5-6,16H2,1-4H3,(H2,24,25,26,27) |
| InChIKey | XYZHVSONPQGXLK-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|