C21H25FN6 — CID 112950013
3-N-[4-(diethylamino)-2-methylphenyl]-5-N-[(4-fluorophenyl)methyl]-1,2,4-triazine-3,5-diamine (PubChem CID 112950013) has the molecular formula C21H25FN6 and a molecular weight of 380.47 g/mol. Its IUPAC name is 3-N-[4-(diethylamino)-2-methylphenyl]-5-N-[(4-fluorophenyl)methyl]-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-[4-(diethylamino)-2-methylphenyl]-5-N-[(4-fluorophenyl)methyl]-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112950013 |
| Molecular Formula | C21H25FN6 |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 3-N-[4-(diethylamino)-2-methylphenyl]-5-N-[(4-fluorophenyl)methyl]-1,2,4-triazine-3,5-diamine |
| SMILES | CCN(CC)c1ccc(Nc2nncc(NCc3ccc(F)cc3)n2)c(C)c1 |
| InChI | InChI=1S/C21H25FN6/c1-4-28(5-2)18-10-11-19(15(3)12-18)25-21-26-20(14-24-27-21)23-13-16-6-8-17(22)9-7-16/h6-12,14H,4-5,13H2,1-3H3,(H2,23,25,26,27) |
| InChIKey | JFUSCZNGYNESEY-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|