C20H32N6 — CID 112960914
3-N-[4-(diethylamino)-2-methylphenyl]-5-N,5-N-dipropyl-1,2,4-triazine-3,5-diamine (PubChem CID 112960914) has the molecular formula C20H32N6 and a molecular weight of 356.52 g/mol. Its IUPAC name is 3-N-[4-(diethylamino)-2-methylphenyl]-5-N,5-N-dipropyl-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-[4-(diethylamino)-2-methylphenyl]-5-N,5-N-dipropyl-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112960914 |
| Molecular Formula | C20H32N6 |
| Molecular Weight | 356.52 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | 3-N-[4-(diethylamino)-2-methylphenyl]-5-N,5-N-dipropyl-1,2,4-triazine-3,5-diamine |
| SMILES | CCCN(CCC)c1cnnc(Nc2ccc(N(CC)CC)cc2C)n1 |
| InChI | InChI=1S/C20H32N6/c1-6-12-26(13-7-2)19-15-21-24-20(23-19)22-18-11-10-17(14-16(18)5)25(8-3)9-4/h10-11,14-15H,6-9,12-13H2,1-5H3,(H,22,23,24) |
| InChIKey | WLTVOTYLKZBNRT-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.52 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|