C15H20BrN5 — CID 112960892
3-N-(3-bromophenyl)-5-N,5-N-dipropyl-1,2,4-triazine-3,5-diamine (PubChem CID 112960892) has the molecular formula C15H20BrN5 and a molecular weight of 350.26 g/mol. Its IUPAC name is 3-N-(3-bromophenyl)-5-N,5-N-dipropyl-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-(3-bromophenyl)-5-N,5-N-dipropyl-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112960892 |
| Molecular Formula | C15H20BrN5 |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 3-N-(3-bromophenyl)-5-N,5-N-dipropyl-1,2,4-triazine-3,5-diamine |
| SMILES | CCCN(CCC)c1cnnc(Nc2cccc(Br)c2)n1 |
| InChI | InChI=1S/C15H20BrN5/c1-3-8-21(9-4-2)14-11-17-20-15(19-14)18-13-7-5-6-12(16)10-13/h5-7,10-11H,3-4,8-9H2,1-2H3,(H,18,19,20) |
| InChIKey | SWEZIRBIAOVTBJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |