C17H25N5O2 — CID 112960867
3-N-(3,4-dimethoxyphenyl)-5-N,5-N-dipropyl-1,2,4-triazine-3,5-diamine (PubChem CID 112960867) has the molecular formula C17H25N5O2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 3-N-(3,4-dimethoxyphenyl)-5-N,5-N-dipropyl-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-(3,4-dimethoxyphenyl)-5-N,5-N-dipropyl-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112960867 |
| Molecular Formula | C17H25N5O2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | 3-N-(3,4-dimethoxyphenyl)-5-N,5-N-dipropyl-1,2,4-triazine-3,5-diamine |
| SMILES | CCCN(CCC)c1cnnc(Nc2ccc(OC)c(OC)c2)n1 |
| InChI | InChI=1S/C17H25N5O2/c1-5-9-22(10-6-2)16-12-18-21-17(20-16)19-13-7-8-14(23-3)15(11-13)24-4/h7-8,11-12H,5-6,9-10H2,1-4H3,(H,19,20,21) |
| InChIKey | IKEGGIRQMZKSDX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |