C18H27N5 — CID 112881982
4-N-[4-(diethylamino)-2-methylphenyl]-2-N-propylpyrimidine-2,4-diamine (PubChem CID 112881982) has the molecular formula C18H27N5 and a molecular weight of 313.45 g/mol. Its IUPAC name is 4-N-[4-(diethylamino)-2-methylphenyl]-2-N-propylpyrimidine-2,4-diamine.
| Compound Name | 4-N-[4-(diethylamino)-2-methylphenyl]-2-N-propylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112881982 |
| Molecular Formula | C18H27N5 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | 4-N-[4-(diethylamino)-2-methylphenyl]-2-N-propylpyrimidine-2,4-diamine |
| SMILES | CCCNc1nccc(Nc2ccc(N(CC)CC)cc2C)n1 |
| InChI | InChI=1S/C18H27N5/c1-5-11-19-18-20-12-10-17(22-18)21-16-9-8-15(13-14(16)4)23(6-2)7-3/h8-10,12-13H,5-7,11H2,1-4H3,(H2,19,20,21,22) |
| InChIKey | WWHADLOYFVFNDD-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|