C17H16N2O3S — CID 112525772
N-(1,3-benzothiazol-6-yl)-3-(3,4-dihydroxyphenyl)-2-methylpropanamide (PubChem CID 112525772) has the molecular formula C17H16N2O3S and a molecular weight of 328.39 g/mol. Its IUPAC name is N-(1,3-benzothiazol-6-yl)-3-(3,4-dihydroxyphenyl)-2-methylpropanamide.
| Compound Name | N-(1,3-benzothiazol-6-yl)-3-(3,4-dihydroxyphenyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 112525772 |
| Molecular Formula | C17H16N2O3S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | N-(1,3-benzothiazol-6-yl)-3-(3,4-dihydroxyphenyl)-2-methylpropanamide |
| SMILES | CC(Cc1ccc(O)c(O)c1)C(=O)Nc1ccc2ncsc2c1 |
| InChI | InChI=1S/C17H16N2O3S/c1-10(6-11-2-5-14(20)15(21)7-11)17(22)19-12-3-4-13-16(8-12)23-9-18-13/h2-5,7-10,20-21H,6H2,1H3,(H,19,22) |
| InChIKey | HSWPGHYOMFSGFI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|