C14H17N3O3S — CID 107806076
2-[(1,3-benzothiazol-6-ylcarbamoylamino)methyl]-3-methylbutanoic acid (PubChem CID 107806076) has the molecular formula C14H17N3O3S and a molecular weight of 307.38 g/mol. Its IUPAC name is 2-[(1,3-benzothiazol-6-ylcarbamoylamino)methyl]-3-methylbutanoic acid.
| Compound Name | 2-[(1,3-benzothiazol-6-ylcarbamoylamino)methyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 107806076 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 2-[(1,3-benzothiazol-6-ylcarbamoylamino)methyl]-3-methylbutanoic acid |
| SMILES | CC(C)C(CNC(=O)Nc1ccc2ncsc2c1)C(=O)O |
| InChI | InChI=1S/C14H17N3O3S/c1-8(2)10(13(18)19)6-15-14(20)17-9-3-4-11-12(5-9)21-7-16-11/h3-5,7-8,10H,6H2,1-2H3,(H,18,19)(H2,15,17,20) |
| InChIKey | YCCUOYJSHGVGDL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |