C13H15N3O3S2 — CID 103995980
2-(1,3-benzothiazol-6-ylcarbamoylamino)-4-methylsulfanylbutanoic acid (PubChem CID 103995980) has the molecular formula C13H15N3O3S2 and a molecular weight of 325.42 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-6-ylcarbamoylamino)-4-methylsulfanylbutanoic acid.
| Compound Name | 2-(1,3-benzothiazol-6-ylcarbamoylamino)-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 103995980 |
| Molecular Formula | C13H15N3O3S2 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 2-(1,3-benzothiazol-6-ylcarbamoylamino)-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)Nc1ccc2ncsc2c1)C(=O)O |
| InChI | InChI=1S/C13H15N3O3S2/c1-20-5-4-10(12(17)18)16-13(19)15-8-2-3-9-11(6-8)21-7-14-9/h2-3,6-7,10H,4-5H2,1H3,(H,17,18)(H2,15,16,19) |
| InChIKey | WFCAETQSIIFZRL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |