C12H9N3O4S — CID 107805868
(E)-4-(1,3-benzothiazol-6-ylcarbamoylamino)-4-oxobut-2-enoic acid (PubChem CID 107805868) has the molecular formula C12H9N3O4S and a molecular weight of 291.29 g/mol. Its IUPAC name is (E)-4-(1,3-benzothiazol-6-ylcarbamoylamino)-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-(1,3-benzothiazol-6-ylcarbamoylamino)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 107805868 |
| Molecular Formula | C12H9N3O4S |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | (E)-4-(1,3-benzothiazol-6-ylcarbamoylamino)-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)NC(=O)Nc1ccc2ncsc2c1 |
| InChI | InChI=1S/C12H9N3O4S/c16-10(3-4-11(17)18)15-12(19)14-7-1-2-8-9(5-7)20-6-13-8/h1-6H,(H,17,18)(H2,14,15,16,19)/b4-3+ |
| InChIKey | FAZCQIBFJWPCNG-ONEGZZNKSA-N |
| XLogP | 1.59 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|