C19H19N3OS — CID 76617091
N-(1,3-benzothiazol-6-yl)-3-(6-tert-butyl-3-pyridinyl)prop-2-enamide (PubChem CID 76617091) has the molecular formula C19H19N3OS and a molecular weight of 337.45 g/mol. Its IUPAC name is N-(1,3-benzothiazol-6-yl)-3-(6-tert-butyl-3-pyridinyl)prop-2-enamide.
| Compound Name | N-(1,3-benzothiazol-6-yl)-3-(6-tert-butyl-3-pyridinyl)prop-2-enamide |
|---|---|
| PubChem CID | 76617091 |
| Molecular Formula | C19H19N3OS |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | N-(1,3-benzothiazol-6-yl)-3-(6-tert-butyl-3-pyridinyl)prop-2-enamide |
| SMILES | CC(C)(C)c1ccc(C=CC(=O)Nc2ccc3ncsc3c2)cn1 |
| InChI | InChI=1S/C19H19N3OS/c1-19(2,3)17-8-4-13(11-20-17)5-9-18(23)22-14-6-7-15-16(10-14)24-12-21-15/h4-12H,1-3H3,(H,22,23) |
| InChIKey | PLEHKFCEBCFIOG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|