C12H15N3OS — CID 114003191
2-amino-N-(1,3-benzothiazol-6-yl)-2-methylbutanamide (PubChem CID 114003191) has the molecular formula C12H15N3OS and a molecular weight of 249.34 g/mol. Its IUPAC name is 2-amino-N-(1,3-benzothiazol-6-yl)-2-methylbutanamide.
| Compound Name | 2-amino-N-(1,3-benzothiazol-6-yl)-2-methylbutanamide |
|---|---|
| PubChem CID | 114003191 |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 2-amino-N-(1,3-benzothiazol-6-yl)-2-methylbutanamide |
| SMILES | CCC(C)(N)C(=O)Nc1ccc2ncsc2c1 |
| InChI | InChI=1S/C12H15N3OS/c1-3-12(2,13)11(16)15-8-4-5-9-10(6-8)17-7-14-9/h4-7H,3,13H2,1-2H3,(H,15,16) |
| InChIKey | QOYNSRVPBYQJOR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |