C12H12N2O3S — CID 114002723
3-(1,3-benzothiazol-6-ylamino)-2,2-dimethyl-3-oxopropanoic acid (PubChem CID 114002723) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-6-ylamino)-2,2-dimethyl-3-oxopropanoic acid.
| Compound Name | 3-(1,3-benzothiazol-6-ylamino)-2,2-dimethyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 114002723 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 3-(1,3-benzothiazol-6-ylamino)-2,2-dimethyl-3-oxopropanoic acid |
| SMILES | CC(C)(C(=O)O)C(=O)Nc1ccc2ncsc2c1 |
| InChI | InChI=1S/C12H12N2O3S/c1-12(2,11(16)17)10(15)14-7-3-4-8-9(5-7)18-6-13-8/h3-6H,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | XDWZZMVOMOBZSL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|