C10H8N2O3S — CID 107800350
methyl 2-(1,3-benzothiazol-6-ylamino)-2-oxoacetate (PubChem CID 107800350) has the molecular formula C10H8N2O3S and a molecular weight of 236.25 g/mol. Its IUPAC name is methyl 2-(1,3-benzothiazol-6-ylamino)-2-oxoacetate.
| Compound Name | methyl 2-(1,3-benzothiazol-6-ylamino)-2-oxoacetate |
|---|---|
| PubChem CID | 107800350 |
| Molecular Formula | C10H8N2O3S |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | methyl 2-(1,3-benzothiazol-6-ylamino)-2-oxoacetate |
| SMILES | COC(=O)C(=O)Nc1ccc2ncsc2c1 |
| InChI | InChI=1S/C10H8N2O3S/c1-15-10(14)9(13)12-6-2-3-7-8(4-6)16-5-11-7/h2-5H,1H3,(H,12,13) |
| InChIKey | NCVMEMFJCYKCIH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|