C8H8N2OS — CID 90120001
N-methoxy-1,3-benzothiazol-6-amine (PubChem CID 90120001) has the molecular formula C8H8N2OS and a molecular weight of 180.23 g/mol. Its IUPAC name is N-methoxy-1,3-benzothiazol-6-amine.
| Compound Name | N-methoxy-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 90120001 |
| Molecular Formula | C8H8N2OS |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | N-methoxy-1,3-benzothiazol-6-amine |
| SMILES | CONc1ccc2ncsc2c1 |
| InChI | InChI=1S/C8H8N2OS/c1-11-10-6-2-3-7-8(4-6)12-5-9-7/h2-5,10H,1H3 |
| InChIKey | DTJDOVOZIRLSAA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|