About N-(2-ethoxyethyl)-1,3-benzothiazol-6-amine
N-(2-ethoxyethyl)-1,3-benzothiazol-6-amine (PubChem CID 107804703) has the molecular formula C11H14N2OS
and a molecular weight of 222.31 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-1,3-benzothiazol-6-amine.
Molecular Properties
| Compound Name | N-(2-ethoxyethyl)-1,3-benzothiazol-6-amine |
| PubChem CID | 107804703 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | N-(2-ethoxyethyl)-1,3-benzothiazol-6-amine |
| SMILES | CCOCCNc1ccc2ncsc2c1 |
| InChI | InChI=1S/C11H14N2OS/c1-2-14-6-5-12-9-3-4-10-11(7-9)15-8-13-10/h3-4,7-8,12H,2,5-6H2,1H3 |
| InChIKey | RSIVSFUOLHESLY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(2-ethoxyethyl)-1,3-benzothiazol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-ethoxyethyl)-1,3-benzothiazol-6-amine?
The IUPAC name of N-(2-ethoxyethyl)-1,3-benzothiazol-6-amine (CID 107804703) is N-(2-ethoxyethyl)-1,3-benzothiazol-6-amine.
What is the SMILES notation for N-(2-ethoxyethyl)-1,3-benzothiazol-6-amine?
The canonical SMILES for N-(2-ethoxyethyl)-1,3-benzothiazol-6-amine is CCOCCNc1ccc2ncsc2c1.
What is the InChIKey of N-(2-ethoxyethyl)-1,3-benzothiazol-6-amine?
The InChIKey is RSIVSFUOLHESLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2OS/c1-2-14-6-5-12-9-3-4-10-11(7-9)15-8-13-10/h3-4,7-8,12H,2,5-6H2,1H3.
What are the key properties of N-(2-ethoxyethyl)-1,3-benzothiazol-6-amine?
N-(2-ethoxyethyl)-1,3-benzothiazol-6-amine has a molecular weight of 222.31 g/mol, XLogP of 2.74, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-ethoxyethyl)-1,3-benzothiazol-6-amine is sourced from PubChem (CID 107804703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).