C11H14N2OS — CID 107804703
N-(2-ethoxyethyl)-1,3-benzothiazol-6-amine (PubChem CID 107804703) has the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-1,3-benzothiazol-6-amine.
| Compound Name | N-(2-ethoxyethyl)-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 107804703 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | N-(2-ethoxyethyl)-1,3-benzothiazol-6-amine |
| SMILES | CCOCCNc1ccc2ncsc2c1 |
| InChI | InChI=1S/C11H14N2OS/c1-2-14-6-5-12-9-3-4-10-11(7-9)15-8-13-10/h3-4,7-8,12H,2,5-6H2,1H3 |
| InChIKey | RSIVSFUOLHESLY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|