C10H7NO2S — CID 83854400
(E)-3-(1,3-benzothiazol-6-yl)prop-2-enoic acid (PubChem CID 83854400) has the molecular formula C10H7NO2S and a molecular weight of 205.24 g/mol. Its IUPAC name is (E)-3-(1,3-benzothiazol-6-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(1,3-benzothiazol-6-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 83854400 |
| Molecular Formula | C10H7NO2S |
| Molecular Weight | 205.24 g/mol |
| Exact Mass | 205.02 |
| IUPAC Name | (E)-3-(1,3-benzothiazol-6-yl)prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc2ncsc2c1 |
| InChI | InChI=1S/C10H7NO2S/c12-10(13)4-2-7-1-3-8-9(5-7)14-6-11-8/h1-6H,(H,12,13)/b4-2+ |
| InChIKey | GWNBBDBCDWFPMF-DUXPYHPUSA-N |
| XLogP | 2.39 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.24 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|