C8H5NO3S — CID 91502581
1,3-benzothiazol-6-yl hydrogen carbonate (PubChem CID 91502581) has the molecular formula C8H5NO3S and a molecular weight of 195.20 g/mol. Its IUPAC name is 1,3-benzothiazol-6-yl hydrogen carbonate.
| Compound Name | 1,3-benzothiazol-6-yl hydrogen carbonate |
|---|---|
| PubChem CID | 91502581 |
| Molecular Formula | C8H5NO3S |
| Molecular Weight | 195.20 g/mol |
| Exact Mass | 195.00 |
| IUPAC Name | 1,3-benzothiazol-6-yl hydrogen carbonate |
| SMILES | O=C(O)Oc1ccc2ncsc2c1 |
| InChI | InChI=1S/C8H5NO3S/c10-8(11)12-5-1-2-6-7(3-5)13-4-9-6/h1-4H,(H,10,11) |
| InChIKey | MKLQWTQQCUGHHW-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.20 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|